| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:37:22 UTC |
|---|
| Update Date | 2025-03-21 17:57:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00009348 |
|---|
| Frequency | 516.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H18O13 |
|---|
| Molecular Mass | 370.0747 |
|---|
| SMILES | O=C(O)C1OC(O)C(O)C(O)C1OC1C(C(=O)O)OC(O)C(O)C1O |
|---|
| InChI Key | OOMADAYRIPNFCC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | glucuronic acid derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidsdialkyl ethersdicarboxylic acids and derivativeshemiacetalshydrocarbon derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanespyran carboxylic acidssecondary alcohols |
|---|
| Substituents | alcoholcarbonyl groupethercarboxylic acidpyran carboxylic acid or derivativesglucuronic acid or derivativesmonosaccharidecarboxylic acid derivativepyran carboxylic aciddialkyl etheroxacycleorganic oxidepyranaliphatic heteromonocyclic compoundsecondary alcoholdicarboxylic acid or derivativeshemiacetalhydrocarbon derivativeoxaneorganoheterocyclic compound |
|---|
