Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-20 23:37:24 UTC |
---|
Update Date | 2025-03-21 17:57:40 UTC |
---|
HMDB ID | HMDB0240373 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00009416 |
---|
Name | 3,5-Dihydroxybenzoic acid sulfate |
---|
Frequency | 512.4 |
---|
Structure | |
---|
Chemical Formula | C7H6O7S |
---|
Molecular Mass | 233.9834 |
---|
SMILES | O=C(O)c1cc(O)cc(OS(=O)(=O)O)c1 |
---|
InChI Key | NDZHPENMJGDGPX-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | organic sulfuric acids and derivatives |
---|
Subclass | arylsulfates |
---|
Direct Parent | phenylsulfates |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzoic acidsbenzoyl derivativescarboxylic acidshydrocarbon derivativeshydroxybenzoic acid derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsphenoxy compoundssulfuric acid monoesters |
---|
Substituents | monocyclic benzene moietysulfuric acid monoestercarboxylic acidbenzoyl1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativephenylsulfateorganic oxidebenzoic acidbenzoic acid or derivatives1-hydroxy-4-unsubstituted benzenoidhydroxybenzoic acidaromatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundsulfate-esterphenolhydrocarbon derivativebenzenoidphenoxy compoundsulfuric acid esterorganooxygen compound |
---|