| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:37:26 UTC |
|---|
| Update Date | 2025-03-21 17:57:41 UTC |
|---|
| HMDB ID | HMDB0003974 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00009500 |
|---|
| Name | Oxalosuccinic acid |
|---|
| Frequency | 506.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H6O7 |
|---|
| Molecular Mass | 190.0114 |
|---|
| SMILES | O=C(O)CC(C(=O)O)C(=O)C(=O)O |
|---|
| InChI Key | UFSCUAXLTRFIDC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | tricarboxylic acids and derivatives |
|---|
| Direct Parent | tricarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | 1,3-dicarbonyl compoundsalpha-hydroxy ketonesalpha-keto acids and derivativesbeta-hydroxy ketonesbeta-keto acids and derivativescarboxylic acidsgamma-keto acids and derivativeshydrocarbon derivativesorganic oxides |
|---|
| Substituents | beta-hydroxy ketonealiphatic acyclic compoundcarbonyl groupcarboxylic acidtricarboxylic acid or derivativesalpha-hydroxy ketonebeta-keto acidgamma-keto acidketoneorganic oxideorganic oxygen compoundketo acidalpha-keto acidhydrocarbon derivative1,3-dicarbonyl compoundorganooxygen compound |
|---|
