| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:37:26 UTC |
|---|
| Update Date | 2025-03-21 17:57:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00009527 |
|---|
| Frequency | 510.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H10N2O2 |
|---|
| Molecular Mass | 190.0742 |
|---|
| SMILES | NC(=O)Cc1c[nH]c2ccc(O)cc12 |
|---|
| InChI Key | XBRZQRWKBWNBEZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indoles |
|---|
| Direct Parent | indoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsazacyclic compoundsbenzenoidscarbonyl compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsprimary carboxylic acid amidespyrroles |
|---|
| Substituents | primary carboxylic acid amidecarbonyl groupazacycleindoleheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidcarboxamide groupcarboxylic acid derivativeorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyrroleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
