| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:37:30 UTC |
|---|
| Update Date | 2025-03-21 17:57:42 UTC |
|---|
| HMDB ID | HMDB0247079 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00009647 |
|---|
| Name | 6-Hydroxymethylpterin |
|---|
| Frequency | 791.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H7N5O2 |
|---|
| Molecular Mass | 193.06 |
|---|
| SMILES | Nc1nc2ncc(CO)nc2c(=O)[nH]1 |
|---|
| InChI Key | XGWIBNWDLMIPNF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | aromatic alcoholsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsorganic oxidesorganopnictogen compoundsprimary aminespyrazinespyrimidones |
|---|
| Substituents | aromatic alcoholalcoholpterinlactamazacycleheteroaromatic compoundpyrimidonepyrimidineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyrazineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
