| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:37:31 UTC |
|---|
| Update Date | 2025-03-21 17:57:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00009692 |
|---|
| Frequency | 494.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H15N5O4 |
|---|
| Molecular Mass | 269.1124 |
|---|
| SMILES | Nc1ncnc2c1ncn2CC(O)C(O)C(O)CO |
|---|
| InChI Key | XJPOQCHDZYRCMG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purines and purine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsn-substituted imidazolesorganopnictogen compoundsprimary alcoholsprimary aminespyrimidines and pyrimidine derivativessecondary alcohols |
|---|
| Substituents | alcoholazacycleheteroaromatic compoundpyrimidineorganic oxygen compoundaromatic heteropolycyclic compoundimidazoleorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundprimary alcoholimidolactamamineorganooxygen compoundazolen-substituted imidazole |
|---|
