| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:37:33 UTC |
|---|
| Update Date | 2025-03-21 17:57:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00009763 |
|---|
| Frequency | 489.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H10O7 |
|---|
| Molecular Mass | 302.0427 |
|---|
| SMILES | O=c1c(-c2cc(O)c(O)c(O)c2)coc2cc(O)cc(O)c12 |
|---|
| InChI Key | JMBPLLMCEJZNRV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | isoflav-2-enes |
|---|
| Direct Parent | isoflavones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativeschromonesheteroaromatic compoundshydrocarbon derivativesisoflavonoidsorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivativespyrogallols and derivativesvinylogous acids |
|---|
| Substituents | monocyclic benzene moiety1-benzopyran1-hydroxy-2-unsubstituted benzenoidorganic oxidechromonearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compoundisoflavonebenzopyranpyrogallol derivativebenzenetriolheteroaromatic compound1-hydroxy-4-unsubstituted benzenoidoxacyclevinylogous acidorganic oxygen compoundpyranphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|