Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-20 23:37:39 UTC |
---|
Update Date | 2025-03-21 17:57:46 UTC |
---|
HMDB ID | HMDB0059636 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00010005 |
---|
Name | 3-(3,5-Diiodo-4-hydroxyphenyl)lactate |
---|
Frequency | 475.6 |
---|
Structure | |
---|
Chemical Formula | C9H8I2O4 |
---|
Molecular Mass | 433.8512 |
---|
SMILES | O=C(O)C(O)Cc1cc(I)c(O)c(I)c1 |
---|
InChI Key | ZPJHINFPRQWKIH-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | phenylpropanoic acids |
---|
Subclass | phenylpropanoic acids |
---|
Direct Parent | phenylpropanoic acids |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | alpha hydroxy acids and derivativesaryl iodidescarbonyl compoundscarboxylic acidshalophenolshydrocarbon derivativesiodobenzenesmonocarboxylic acids and derivativeso-iodophenolsorganic oxidesorganoiodidessecondary alcohols |
---|
Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acid3-phenylpropanoic-acidalpha-hydroxy acidcarboxylic acid derivativeorganohalogen compoundiodobenzeneorganoiodideorganic oxidealcohol2-iodophenolhydroxy acidaryl halidearomatic homomonocyclic compound2-halophenolmonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholphenolhydrocarbon derivativebenzenoidaryl iodidehalobenzeneorganooxygen compound |
---|