| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:37:39 UTC |
|---|
| Update Date | 2025-03-21 17:57:46 UTC |
|---|
| HMDB ID | HMDB0059636 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00010005 |
|---|
| Name | 3-(3,5-Diiodo-4-hydroxyphenyl)lactate |
|---|
| Frequency | 475.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H8I2O4 |
|---|
| Molecular Mass | 433.8512 |
|---|
| SMILES | O=C(O)C(O)Cc1cc(I)c(O)c(I)c1 |
|---|
| InChI Key | ZPJHINFPRQWKIH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | phenylpropanoic acids |
|---|
| Subclass | phenylpropanoic acids |
|---|
| Direct Parent | phenylpropanoic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativesaryl iodidescarbonyl compoundscarboxylic acidshalophenolshydrocarbon derivativesiodobenzenesmonocarboxylic acids and derivativeso-iodophenolsorganic oxidesorganoiodidessecondary alcohols |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acid3-phenylpropanoic-acidalpha-hydroxy acidcarboxylic acid derivativeorganohalogen compoundiodobenzeneorganoiodideorganic oxidealcohol2-iodophenolhydroxy acidaryl halidearomatic homomonocyclic compound2-halophenolmonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholphenolhydrocarbon derivativebenzenoidaryl iodidehalobenzeneorganooxygen compound |
|---|