Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-20 23:37:42 UTC |
---|
Update Date | 2025-03-21 17:57:47 UTC |
---|
HMDB ID | HMDB0301717 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00010115 |
---|
Name | Ferulic acid 4-glucoside |
---|
Frequency | 469.7 |
---|
Structure | |
---|
Chemical Formula | C16H20O9 |
---|
Molecular Mass | 356.1107 |
---|
SMILES | COc1cc(C=CC(=O)O)ccc1OC1OC(CO)C(O)C(O)C1O |
---|
InChI Key | IEMIRSXOYFWPFD-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | cinnamic acids and derivatives |
---|
Subclass | cinnamic acids and derivatives |
---|
Direct Parent | cinnamic acids and derivatives |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | acetalsalkyl aryl ethersanisolescarbonyl compoundscarboxylic acidshydrocarbon derivativesmethoxybenzenesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenoxy compoundsprimary alcoholssecondary alcohols |
---|
Substituents | phenol ethermonocyclic benzene moietycarbonyl groupethercarboxylic acidaromatic heteromonocyclic compoundmonosaccharidealkyl aryl ethercarboxylic acid derivativecinnamic acid or derivativessaccharideorganic oxideacetaloxaneprimary alcoholorganoheterocyclic compoundalcoholmethoxybenzeneoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundanisolesecondary alcoholhydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compound |
---|