| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:37:43 UTC |
|---|
| Update Date | 2025-03-21 17:57:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00010161 |
|---|
| Frequency | 467.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H10N5O5P |
|---|
| Molecular Mass | 299.042 |
|---|
| SMILES | Nc1ncnc2c1ncn2C1OC2COP(=O)(O)OC21 |
|---|
| InChI Key | RGEQCNMMEATQMX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purines and purine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsn-substituted imidazolesorganic oxidesorganic phosphoric acids and derivativesorganooxygen compoundsorganopnictogen compoundsoxacyclic compoundsoxetanesprimary aminespyrimidines and pyrimidine derivatives |
|---|
| Substituents | azacycleheteroaromatic compoundpyrimidineoxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundimidazoleoxetaneorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary aminepurineorganic nitrogen compoundimidolactamorganic phosphoric acid derivativeamineorganooxygen compoundazolen-substituted imidazole |
|---|
