Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-20 23:37:43 UTC |
---|
Update Date | 2025-03-21 17:57:47 UTC |
---|
HMDB ID | HMDB0040930 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00010171 |
---|
Name | 1,5-Bis(4-hydroxy-3-methoxyphenyl)-1,4-pentadien-3-one |
---|
Frequency | 467.1 |
---|
Structure | |
---|
Chemical Formula | C19H18O5 |
---|
Molecular Mass | 326.1154 |
---|
SMILES | COc1cc(C=CC(=O)C=Cc2ccc(O)c(OC)c2)ccc1O |
---|
InChI Key | ISIMGBQRFXXNON-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | cinnamic acids and derivatives |
---|
Subclass | hydroxycinnamic acids and derivatives |
---|
Direct Parent | hydroxycinnamic acids |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsacryloyl compoundsalkyl aryl ethersanisolesenoneshydrocarbon derivativesketonesmethoxybenzenesmethoxyphenolsorganic oxidesphenoxy compounds |
---|
Substituents | phenol ethermonocyclic benzene moietycarbonyl groupether1-hydroxy-2-unsubstituted benzenoidmethoxyphenolalkyl aryl etheralpha,beta-unsaturated ketoneketoneorganic oxideenonemethoxybenzenehydroxycinnamic acidaromatic homomonocyclic compoundorganic oxygen compoundanisolephenolhydrocarbon derivativebenzenoidacryloyl-groupphenoxy compoundorganooxygen compound |
---|