| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:37:45 UTC |
|---|
| Update Date | 2025-03-21 17:57:48 UTC |
|---|
| HMDB ID | HMDB0125206 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00010259 |
|---|
| Name | 2-(3,5-dihydroxyphenyl)-3,5,7-trihydroxy-4H-chromen-4-one |
|---|
| Frequency | 462.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H10O7 |
|---|
| Molecular Mass | 302.0427 |
|---|
| SMILES | O=c1c(O)c(-c2cc(O)cc(O)c2)oc2cc(O)cc(O)c12 |
|---|
| InChI Key | UXOUKMQIEVGVLY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | flavones |
|---|
| Direct Parent | flavonols |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3'-hydroxyflavonoids3-hydroxyflavonoids5-hydroxyflavonoids7-hydroxyflavonoidsbenzene and substituted derivativeschromonesflavonoidsheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivativesresorcinolsvinylogous acids |
|---|
| Substituents | 3-hydroxyflavonemonocyclic benzene moiety3-hydroxyflavonoid1-benzopyran1-hydroxy-2-unsubstituted benzenoidresorcinolorganic oxidechromonearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compoundbenzopyranheteroaromatic compound5-hydroxyflavonoid1-hydroxy-4-unsubstituted benzenoid3'-hydroxyflavonoidoxacyclevinylogous acidorganic oxygen compoundpyran7-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
