Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-20 23:37:46 UTC |
---|
Update Date | 2025-03-21 17:57:48 UTC |
---|
HMDB ID | HMDB0038663 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00010276 |
---|
Name | D-1-[(3-Carboxypropyl)amino]-1-deoxyfructose |
---|
Frequency | 461.1 |
---|
Structure | |
---|
Chemical Formula | C10H19NO7 |
---|
Molecular Mass | 265.1162 |
---|
SMILES | O=C(O)CCCNCC1(O)OC(CO)C(O)C1O |
---|
InChI Key | HUEOABWGBTXQNF-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | gamma amino acids and derivatives |
---|
Geometric Descriptor | aliphatic heteromonocyclic compounds |
---|
Alternative Parents | amino acidscarbonyl compoundscarboxylic acidsdialkylamineshemiacetalsheterocyclic fatty acidshydrocarbon derivativeshydroxy fatty acidsmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganopnictogen compoundsoxacyclic compoundsprimary alcoholssecondary alcoholsshort-chain hydroxy acids and derivativestetrahydrofurans |
---|
Substituents | fatty acylcarbonyl groupcarboxylic acidshort-chain hydroxy acidamino acidheterocyclic fatty acidgamma amino acid or derivativesmonosaccharidefatty acidsaccharideorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetalhydroxy fatty acidprimary alcoholorganoheterocyclic compoundalcoholsecondary aliphatic aminetetrahydrofuransecondary amineoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundamine |
---|