| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:37:46 UTC |
|---|
| Update Date | 2025-03-21 17:57:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00010300 |
|---|
| Frequency | 459.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H9O9P |
|---|
| Molecular Mass | 243.9984 |
|---|
| SMILES | O=C(O)C1OC(OP(=O)(O)O)C(O)C1O |
|---|
| InChI Key | QHZYBRAUIKSNNS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | pentose phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundssecondary alcoholstetrahydrofurans |
|---|
| Substituents | carbonyl groupcarboxylic acidpentose phosphatecarboxylic acid derivativebeta-hydroxy acidorganic oxidealiphatic heteromonocyclic compoundorganoheterocyclic compound1,2-diolalcoholtetrahydrofuranhydroxy acidoxacyclemonocarboxylic acid or derivativesphosphoric acid estermonoalkyl phosphatesecondary alcoholhydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphate |
|---|
