| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:37:53 UTC |
|---|
| Update Date | 2025-03-21 17:57:50 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00010569 |
|---|
| Frequency | 444.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H16N2O4 |
|---|
| Molecular Mass | 264.111 |
|---|
| SMILES | NC(CCC(=O)NC(=O)Cc1ccccc1)C(=O)O |
|---|
| InChI Key | ATRXQWWVHZGSTB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | glutamine and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidscarbonyl compoundscarboxylic acidsdicarboximideshydrocarbon derivativesmonoalkylaminesmonocarboxylic acids and derivativesn-acyl aminesn-unsubstituted carboxylic acid imidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenylacetamides |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidglutamine or derivativesn-acyl-aminecarboxylic acid imidearomatic homomonocyclic compoundcarboxylic acid imide, n-unsubstitutedorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydrocarbon derivativebenzenoidprimary aliphatic aminedicarboximideorganic nitrogen compoundphenylacetamideorganooxygen compound |
|---|
