Record Information |
---|
HMDB Status | predicted |
---|
Creation Date | 2024-02-20 23:37:56 UTC |
---|
Update Date | 2025-03-21 17:57:51 UTC |
---|
HMDB ID | HMDB0130016 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00010676 |
---|
Name | 2-[4-(sulfooxy)phenyl]propanoic acid |
---|
Frequency | 439.2 |
---|
Structure | |
---|
Chemical Formula | C9H10O6S |
---|
Molecular Mass | 246.0198 |
---|
SMILES | CC(C(=O)O)c1ccc(OS(=O)(=O)O)cc1 |
---|
InChI Key | DJLDNMBLBSDGQR-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | phenylpropanoic acids |
---|
Subclass | phenylpropanoic acids |
---|
Direct Parent | phenylpropanoic acids |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | carbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesphenoxy compoundsphenylsulfatessulfuric acid monoesters |
---|
Substituents | monocyclic benzene moietysulfuric acid monoestercarbonyl groupcarboxylic acidorganic sulfuric acid or derivativescarboxylic acid derivativearomatic homomonocyclic compoundphenylsulfateorganic oxidemonocarboxylic acid or derivativesorganic oxygen compound2-phenylpropanoic-acidsulfate-esterhydrocarbon derivativearylsulfatebenzenoidphenoxy compoundsulfuric acid esterorganooxygen compound |
---|