| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:37:56 UTC |
|---|
| Update Date | 2025-03-21 17:57:51 UTC |
|---|
| HMDB ID | HMDB0130016 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00010676 |
|---|
| Name | 2-[4-(sulfooxy)phenyl]propanoic acid |
|---|
| Frequency | 439.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H10O6S |
|---|
| Molecular Mass | 246.0198 |
|---|
| SMILES | CC(C(=O)O)c1ccc(OS(=O)(=O)O)cc1 |
|---|
| InChI Key | DJLDNMBLBSDGQR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | phenylpropanoic acids |
|---|
| Subclass | phenylpropanoic acids |
|---|
| Direct Parent | phenylpropanoic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesphenoxy compoundsphenylsulfatessulfuric acid monoesters |
|---|
| Substituents | monocyclic benzene moietysulfuric acid monoestercarbonyl groupcarboxylic acidorganic sulfuric acid or derivativescarboxylic acid derivativearomatic homomonocyclic compoundphenylsulfateorganic oxidemonocarboxylic acid or derivativesorganic oxygen compound2-phenylpropanoic-acidsulfate-esterhydrocarbon derivativearylsulfatebenzenoidphenoxy compoundsulfuric acid esterorganooxygen compound |
|---|