| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:37:57 UTC |
|---|
| Update Date | 2025-03-21 17:57:52 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00010733 |
|---|
| Frequency | 444.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H12BrN3O |
|---|
| Molecular Mass | 281.0164 |
|---|
| SMILES | NC(=O)C(N)Cc1c[nH]c2ccc(Br)cc12 |
|---|
| InChI Key | LBZNSCUOWPUQRL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | aryl bromidesazacyclic compoundsbenzenoidscarbonyl compoundscarboxylic acids and derivativesfatty amidesheteroaromatic compoundshydrocarbon derivativesindolesmonoalkylaminesorganic oxidesorganobromidesorganonitrogen compoundsorganopnictogen compoundsprimary carboxylic acid amidespyrroles |
|---|
| Substituents | primary carboxylic acid amidefatty acylcarbonyl groupindolefatty amideorganohalogen compoundorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganoheterocyclic compoundazacycleheteroaromatic compoundindole or derivativescarboxamide grouparyl halideorganic oxygen compoundpyrroleorganobromidehydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundaryl bromideorganooxygen compound |
|---|