| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:38:02 UTC |
|---|
| Update Date | 2025-03-21 17:57:54 UTC |
|---|
| HMDB ID | HMDB0240569 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00010916 |
|---|
| Name | Urolithin-3-sulfate |
|---|
| Frequency | 427.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H8O6S |
|---|
| Molecular Mass | 292.0042 |
|---|
| SMILES | O=c1oc2cc(OS(=O)(=O)O)ccc2c2ccccc12 |
|---|
| InChI Key | LRRVKQQFGIEMSA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | coumarins and derivatives |
|---|
| Subclass | coumarins and derivatives |
|---|
| Direct Parent | coumarins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans2-benzopyransarylsulfatesbenzenoidsheteroaromatic compoundshydrocarbon derivativesisocoumarins and derivativeslactonesorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivativessulfuric acid monoesters |
|---|
| Substituents | sulfuric acid monoesterbenzopyranorganic sulfuric acid or derivatives1-benzopyranheteroaromatic compoundisocoumarincoumarinlactoneoxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyran2-benzopyranpyranonesulfate-esterhydrocarbon derivativearylsulfatebenzenoidsulfuric acid esterorganoheterocyclic compoundorganooxygen compound |
|---|
