| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:38:04 UTC |
|---|
| Update Date | 2025-03-21 17:57:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00010971 |
|---|
| Frequency | 425.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H8O8S |
|---|
| Molecular Mass | 227.994 |
|---|
| SMILES | O=C(CCC(O)C(=O)O)OS(=O)(=O)O |
|---|
| InChI Key | XKRKXQXRWFPCRR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acids and conjugates |
|---|
| Direct Parent | hydroxy fatty acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesmonosaccharidesorganic oxidessecondary alcoholsshort-chain hydroxy acids and derivativessulfuric acid monoesters |
|---|
| Substituents | alcoholaliphatic acyclic compoundsulfuric acid monoestercarbonyl groupcarboxylic acidorganic sulfuric acid or derivativesshort-chain hydroxy acidalpha-hydroxy acidmonosaccharidehydroxy acidcarboxylic acid derivativesaccharideorganic oxideorganic oxygen compoundsecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativehydroxy fatty acidsulfuric acid esterorganooxygen compound |
|---|
