| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:38:05 UTC |
|---|
| Update Date | 2025-03-21 17:57:55 UTC |
|---|
| HMDB ID | HMDB0126595 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00011009 |
|---|
| Name | 3-[3-methoxy-4-(sulfooxy)phenyl]-2-oxopropanoic acid |
|---|
| Frequency | 423.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H10O8S |
|---|
| Molecular Mass | 290.0096 |
|---|
| SMILES | COc1cc(CC(=O)C(=O)O)ccc1OS(=O)(=O)O |
|---|
| InChI Key | DYMIWVZZOIJKLJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylpyruvic acid derivatives |
|---|
| Direct Parent | phenylpyruvic acid derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersalpha-hydroxy ketonesalpha-keto acids and derivativesanisolescarboxylic acidshydrocarbon derivativesmethoxybenzenesmonocarboxylic acids and derivativesorganic oxidesphenoxy compoundsphenylpropanoic acidsphenylsulfatessulfuric acid monoesters |
|---|
| Substituents | phenol ethersulfuric acid monoestercarbonyl groupethercarboxylic acid3-phenylpropanoic-acidalkyl aryl etheralpha-hydroxy ketonecarboxylic acid derivativeketonephenylsulfateorganic oxidealpha-keto acidarylsulfateorganic sulfuric acid or derivativesphenylpyruvatemethoxybenzenearomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundanisoleketo acidsulfate-esterhydrocarbon derivativephenoxy compoundsulfuric acid esterorganooxygen compound |
|---|
