| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:38:07 UTC |
|---|
| Update Date | 2025-03-21 17:57:55 UTC |
|---|
| HMDB ID | HMDB0129349 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00011089 |
|---|
| Name | 2-(3-hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)propan-1-one |
|---|
| Frequency | 419.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H14O5 |
|---|
| Molecular Mass | 274.0841 |
|---|
| SMILES | CC(C(=O)c1c(O)cc(O)cc1O)c1cccc(O)c1 |
|---|
| InChI Key | UYAKJOSTERJTGV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | alpha-methyldeoxybenzoin flavonoids |
|---|
| Subclass | alpha-methyldeoxybenzoin flavonoids |
|---|
| Direct Parent | alpha-methyldeoxybenzoin flavonoids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacylphloroglucinols and derivativesalkyl-phenylketonesaryl alkyl ketonesbenzoyl derivativeshydrocarbon derivativesorganic oxidesorganooxygen compoundsphenylpropanesstilbenesvinylogous acids |
|---|
| Substituents | acylphloroglucinol derivativemonocyclic benzene moietyaryl alkyl ketonebenzenetriolbenzoyl1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidphenylketonealpha-methyldeoxybenzoin flavonoidketonephenylpropanephloroglucinol derivativearomatic homomonocyclic compoundvinylogous acidorganic oxideorganic oxygen compoundphenolhydrocarbon derivativebenzenoidalkyl-phenylketoneorganooxygen compoundaryl ketonestilbene |
|---|