Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-20 23:38:07 UTC |
---|
Update Date | 2025-03-21 17:57:55 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00011090 |
---|
Frequency | 419.5 |
---|
Structure | |
---|
Chemical Formula | C14H13ClN2O4S |
---|
Molecular Mass | 340.0285 |
---|
SMILES | NS(=O)(=O)c1cc(C(=O)O)c(NCc2ccccc2)cc1Cl |
---|
InChI Key | QQLNFWFHBAFHPR-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | benzenoids |
---|
Class | benzene and substituted derivatives |
---|
Subclass | benzenesulfonamides |
---|
Direct Parent | benzenesulfonamides |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 1-carboxy-2-haloaromatic compounds4-halobenzoic acidsamino acidsaminosulfonyl compoundsaryl chloridesbenzenesulfonyl compoundsbenzoic acidsbenzoyl derivativeschlorobenzeneshalobenzoic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganochloridesorganooxygen compoundsorganopnictogen compoundsorganosulfonamidesphenylalkylaminessecondary alkylarylaminesvinylogous amides |
---|
Substituents | organosulfonic acid or derivativescarboxylic acidamino acid or derivativesamino acidorganochloridebenzoylorganosulfur compoundcarboxylic acid derivativeorganohalogen compoundorganosulfonic acid amideorganic oxideorganonitrogen compoundorganopnictogen compound1-carboxy-2-haloaromatic compoundbenzoic acidbenzenesulfonyl grouparyl chloridechlorobenzenevinylogous amidehalobenzoic acidbenzenesulfonamide4-halobenzoic acidaminosulfonyl compoundbenzoic acid or derivativeshalobenzoic acid or derivativessecondary aminesecondary aliphatic/aromatic aminearyl halide4-halobenzoic acid or derivativesaromatic homomonocyclic compoundmonocarboxylic acid or derivativessulfonylorganic oxygen compoundorganic sulfonic acid or derivativesphenylalkylaminehydrocarbon derivativeorganic nitrogen compoundhalobenzeneamineorganooxygen compound |
---|