| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:38:08 UTC |
|---|
| Update Date | 2025-03-21 17:57:56 UTC |
|---|
| HMDB ID | HMDB0059993 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00011129 |
|---|
| Name | 5-(Hydroxyphenyl)-gamma-valerolactone-O-sulphate |
|---|
| Frequency | 418.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H12O6S |
|---|
| Molecular Mass | 272.0355 |
|---|
| SMILES | O=C1CCC(Cc2cccc(OS(=O)(=O)O)c2)O1 |
|---|
| InChI Key | DPRDYFJWDRNYAZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | phenylsulfates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acid estersgamma butyrolactoneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsphenoxy compoundssulfuric acid monoesterstetrahydrofurans |
|---|
| Substituents | monocyclic benzene moietysulfuric acid monoestercarbonyl grouparomatic heteromonocyclic compoundtetrahydrofurancarboxylic acid derivativegamma butyrolactonelactonephenylsulfateoxacycleorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid estersulfate-esterhydrocarbon derivativebenzenoidphenoxy compoundsulfuric acid esterorganoheterocyclic compoundorganooxygen compound |
|---|
