| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:38:10 UTC |
|---|
| Update Date | 2025-03-21 17:57:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00011216 |
|---|
| Frequency | 422.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H13N5O4 |
|---|
| Molecular Mass | 267.0968 |
|---|
| SMILES | CC(O)C(O)C(=O)C1=Nc2c([nH]c(N)nc2=O)NC1 |
|---|
| InChI Key | ZLNHPGAGIIUBEL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsacyloinsazacyclic compoundsbeta-hydroxy ketonesheteroaromatic compoundshydrocarbon derivativesketiminesmonosaccharidesorganic oxidesorganopnictogen compoundsprimary aminespropargyl-type 1,3-dipolar organic compoundspyrimidonessecondary alcoholssecondary alkylarylaminesvinylogous amides |
|---|
| Substituents | beta-hydroxy ketoneketiminecarbonyl groupiminemonosaccharidepyrimidonepyrimidinepropargyl-type 1,3-dipolar organic compoundketonesaccharideorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compound1,2-diolalcoholvinylogous amidepterinazacycleheteroaromatic compoundorganic 1,3-dipolar compoundsecondary aminesecondary aliphatic/aromatic amineorganic oxygen compoundacyloinsecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
