| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:38:13 UTC |
|---|
| Update Date | 2025-03-21 17:57:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00011316 |
|---|
| Frequency | 590.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H7N5O2 |
|---|
| Molecular Mass | 181.06 |
|---|
| SMILES | Nc1nc(=O)c2c([nH]1)NCC(O)=N2 |
|---|
| InChI Key | JLRDKNBQJOODBP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscyclic carboximidic acidsheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary aminespropargyl-type 1,3-dipolar organic compoundspyrimidonessecondary alkylarylaminesvinylogous amides |
|---|
| Substituents | vinylogous amidepterinazacycleheteroaromatic compoundpyrimidoneorganic 1,3-dipolar compoundsecondary aminesecondary aliphatic/aromatic aminepyrimidinepropargyl-type 1,3-dipolar organic compoundorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundcyclic carboximidic acidamineorganooxygen compound |
|---|
