Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-20 23:38:13 UTC |
---|
Update Date | 2025-03-21 17:57:57 UTC |
---|
HMDB ID | HMDB0240563 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00011321 |
---|
Name | Tyrosol glucuronide |
---|
Frequency | 409.3 |
---|
Structure | |
---|
Chemical Formula | C14H18O8 |
---|
Molecular Mass | 314.1002 |
---|
SMILES | O=C(O)C1OC(Oc2ccc(CCO)cc2)C(O)C(O)C1O |
---|
InChI Key | HEIHXCBRTPYOMU-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic oxygen compounds |
---|
Class | organooxygen compounds |
---|
Subclass | carbohydrates and carbohydrate conjugates |
---|
Direct Parent | o-glucuronides |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | acetalsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsglucuronic acid derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenol ethersphenoxy compoundspyran carboxylic acidssecondary alcoholstyrosols and derivatives |
---|
Substituents | phenol ethermonocyclic benzene moietycarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundo-glucuronidemonosaccharidecarboxylic acid derivativepyran carboxylic acid1-o-glucuronidebeta-hydroxy acidorganic oxideacetaltyrosol derivativeoxaneorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativeshydroxy acidoxacyclemonocarboxylic acid or derivativespyransecondary alcoholhydrocarbon derivativebenzenoidphenoxy compound |
---|