Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-20 23:38:16 UTC |
---|
Update Date | 2025-03-21 17:57:59 UTC |
---|
HMDB ID | HMDB0011112 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00011443 |
---|
Name | N1-(alpha-D-ribosyl)-5,6-dimethyl-benzimidazole |
---|
Frequency | 404.2 |
---|
Structure | |
---|
Chemical Formula | C14H18N2O4 |
---|
Molecular Mass | 278.1267 |
---|
SMILES | Cc1cc2ncn(C3OC(CO)C(O)C3O)c2cc1C |
---|
InChI Key | HLRUKOJSWOKCPP-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | nucleosides, nucleotides, and analogues |
---|
Class | benzimidazole ribonucleosides and ribonucleotides |
---|
Subclass | benzimidazole ribonucleosides and ribonucleotides |
---|
Direct Parent | benzimidazole ribonucleosides and ribonucleotides |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | azacyclic compoundsbenzenoidsbenzimidazolesheteroaromatic compoundshydrocarbon derivativesimidazolesmonosaccharidesn-substituted imidazolesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholssecondary alcoholstetrahydrofurans |
---|
Substituents | alcoholazacycle1-ribofuranosylbenzimidazoletetrahydrofuranheteroaromatic compoundmonosaccharideoxacyclesaccharideorganic oxygen compoundaromatic heteropolycyclic compoundbenzimidazoleimidazoleorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundprimary alcoholorganoheterocyclic compoundorganooxygen compoundazolen-substituted imidazole |
---|