| Record Information |
|---|
| HMDB Status | quantified |
|---|
| Creation Date | 2024-02-20 23:38:16 UTC |
|---|
| Update Date | 2025-03-21 17:57:59 UTC |
|---|
| HMDB ID | HMDB0002215 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00011446 |
|---|
| Name | 4a-Carbinolamine tetrahydrobiopterin |
|---|
| Frequency | 434.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H13N5O3 |
|---|
| Molecular Mass | 239.1018 |
|---|
| SMILES | CC(O)C(O)C1CN=c2nc(N)[nH]c(=O)c2=N1 |
|---|
| InChI Key | ZHQJVZLJDXWFFX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsorganic oxidesorganopnictogen compoundsprimary aminespyrimidonessecondary alcohols |
|---|
| Substituents | alcoholpterinlactamazacycleheteroaromatic compoundpyrimidonepyrimidineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound1,2-diol |
|---|
