Record Information |
---|
HMDB Status | detected |
---|
Creation Date | 2024-02-20 23:38:18 UTC |
---|
Update Date | 2025-03-21 17:58:00 UTC |
---|
HMDB ID | HMDB0240453 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00011518 |
---|
Name | 4-Feruloylquinic acid |
---|
Frequency | 401.0 |
---|
Structure | |
---|
Chemical Formula | C17H20O9 |
---|
Molecular Mass | 368.1107 |
---|
SMILES | COc1cc(C=CC(=O)OC2C(O)CC(O)(C(=O)O)CC2O)ccc1O |
---|
InChI Key | VTMFDSJJVNQXLT-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic oxygen compounds |
---|
Class | organooxygen compounds |
---|
Subclass | alcohols and polyols |
---|
Direct Parent | quinic acids and derivatives |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersalpha hydroxy acids and derivativesanisolescarbonyl compoundscarboxylic acidscyclohexanolsdicarboxylic acids and derivativesenoate estersfatty acid estershydrocarbon derivativeshydroxycinnamic acidsmethoxybenzenesmethoxyphenolsorganic oxidesphenoxy compoundstertiary alcohols |
---|
Substituents | fatty acylphenol ethermonocyclic benzene moietycarbonyl groupethercarboxylic acidalpha-hydroxy acid1-hydroxy-2-unsubstituted benzenoidmethoxyphenolalkyl aryl ethercarboxylic acid derivativehydroxycinnamic acid or derivativesalpha,beta-unsaturated carboxylic estercinnamic acid or derivativesorganic oxideenoate estercyclohexanolhydroxy acidmethoxybenzenehydroxycinnamic acidaromatic homomonocyclic compoundfatty acid estertertiary alcoholanisolecarboxylic acid estersecondary alcoholdicarboxylic acid or derivativesphenolhydrocarbon derivativebenzenoidphenoxy compoundquinic acid |
---|