| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:38:19 UTC |
|---|
| Update Date | 2025-03-21 17:58:00 UTC |
|---|
| HMDB ID | HMDB0132449 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00011561 |
|---|
| Name | 3-(3,5-dihydroxyphenyl)-2-oxopropanoic acid |
|---|
| Frequency | 398.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H8O5 |
|---|
| Molecular Mass | 196.0372 |
|---|
| SMILES | O=C(O)C(=O)Cc1cc(O)cc(O)c1 |
|---|
| InChI Key | QTFICVDVUDQTCE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylpyruvic acid derivatives |
|---|
| Direct Parent | phenylpyruvic acid derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalpha-hydroxy ketonesalpha-keto acids and derivativescarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesphenylpropanoic acidsresorcinols |
|---|
| Substituents | carbonyl groupcarboxylic acidphenylpyruvate3-phenylpropanoic-acid1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidalpha-hydroxy ketonecarboxylic acid derivativeresorcinolketonearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundketo acidalpha-keto acidphenolhydrocarbon derivativeorganooxygen compound |
|---|