| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:38:22 UTC |
|---|
| Update Date | 2025-03-21 17:58:01 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00011683 |
|---|
| Frequency | 394.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H14N2O8 |
|---|
| Molecular Mass | 326.075 |
|---|
| SMILES | O=C(O)CC(N=CC=C1C=C(C(=O)O)NC(C(=O)O)C1)C(=O)O |
|---|
| InChI Key | YHGOPYILBIAFGW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | aspartic acid and derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | aldiminesalpha amino acidsamino acidsazacyclic compoundscarbonyl compoundscarboxylic acidsdialkylamineshydrocarbon derivativesorganic oxidesorganopnictogen compoundspropargyl-type 1,3-dipolar organic compoundstetracarboxylic acids and derivativestetrahydropyridines |
|---|
| Substituents | carbonyl groupcarboxylic acidamino acidiminepropargyl-type 1,3-dipolar organic compoundaldimineorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundorganoheterocyclic compoundsecondary aliphatic amineazacycletetrahydropyridinetetracarboxylic acid or derivativesorganic 1,3-dipolar compoundsecondary amineorganic oxygen compoundaspartic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundamine |
|---|
