| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:38:22 UTC |
|---|
| Update Date | 2025-03-21 17:58:01 UTC |
|---|
| HMDB ID | HMDB0135596 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00011696 |
|---|
| Name | 1-(2-hydroxyphenyl)-3-(4-hydroxyphenyl)propan-1-one |
|---|
| Frequency | 393.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H14O3 |
|---|
| Molecular Mass | 242.0943 |
|---|
| SMILES | O=C(CCc1ccc(O)cc1)c1ccccc1O |
|---|
| InChI Key | XDTIWXQUWIKIMB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | linear 1,3-diarylpropanoids |
|---|
| Subclass | chalcones and dihydrochalcones |
|---|
| Direct Parent | 2'-hydroxy-dihydrochalcones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl-phenylketonesaryl alkyl ketonesbenzoyl derivativesbutyrophenonescinnamylphenolshydrocarbon derivativesorganic oxidesorganooxygen compoundsvinylogous acids |
|---|
| Substituents | monocyclic benzene moiety2'-hydroxy-dihydrochalconearyl alkyl ketonebenzoyl1-hydroxy-2-unsubstituted benzenoidcinnamylphenol1-hydroxy-4-unsubstituted benzenoidphenylketoneketonebutyrophenonearomatic homomonocyclic compoundvinylogous acidorganic oxideorganic oxygen compoundphenolhydrocarbon derivativebenzenoidalkyl-phenylketoneorganooxygen compoundaryl ketone |
|---|
