| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:38:23 UTC |
|---|
| Update Date | 2025-03-21 17:58:01 UTC |
|---|
| HMDB ID | HMDB0125091 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00011709 |
|---|
| Name | 3,5,7-trihydroxy-2-phenyl-1λ⁴-chromen-1-ylium |
|---|
| Frequency | 393.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H11O4+ |
|---|
| Molecular Mass | 255.0652 |
|---|
| SMILES | Oc1cc(O)c2cc(O)c(-c3ccccc3)[o+]c2c1 |
|---|
| InChI Key | IRXCKMTUSTWLNZ-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | hydroxyflavonoids |
|---|
| Direct Parent | 3-hydroxyflavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids5-hydroxyflavonoids7-hydroxyflavonoidsanthocyanidinsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesorganic cationsorganooxygen compoundsoxacyclic compounds |
|---|
| Substituents | 3-hydroxyflavonoidmonocyclic benzene moietybenzopyran1-benzopyranheteroaromatic compound5-hydroxyflavonoid1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidoxacycleorganic oxygen compoundaromatic heteropolycyclic compound7-hydroxyflavonoidanthocyanidinhydrocarbon derivativebenzenoidorganic cationorganoheterocyclic compoundorganooxygen compound |
|---|
