| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:38:24 UTC |
|---|
| Update Date | 2025-03-21 17:58:02 UTC |
|---|
| HMDB ID | HMDB0014568 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00011782 |
|---|
| Name | Hyoscyamine |
|---|
| Frequency | 390.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H23NO3 |
|---|
| Molecular Mass | 289.1678 |
|---|
| SMILES | CN1C2CCC1CC(OC(=O)C(CO)c1ccccc1)C2 |
|---|
| InChI Key | RKUNBYITZUJHSG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | alkaloids and derivatives |
|---|
| Class | tropane alkaloids |
|---|
| Subclass | tropane alkaloids |
|---|
| Direct Parent | tropane alkaloids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesazacyclic compoundsbenzene and substituted derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acid estershydrocarbon derivativesmonocarboxylic acids and derivativesn-alkylpyrrolidinesorganic oxidesorganopnictogen compoundspiperidinesprimary alcoholstrialkylamines |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupamino acid or derivativescarboxylic acid derivativebeta-hydroxy acidorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundpyrrolidineprimary alcoholpiperidinetertiary amineorganoheterocyclic compoundalcoholazacyclen-alkylpyrrolidinetertiary aliphatic aminehydroxy acidmonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esterhydrocarbon derivativebenzenoidorganic nitrogen compoundtropane alkaloidamineorganooxygen compound |
|---|
