Record Information |
---|
HMDB Status | quantified |
---|
Creation Date | 2024-02-20 23:38:27 UTC |
---|
Update Date | 2025-03-21 17:58:02 UTC |
---|
HMDB ID | HMDB0002209 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00011884 |
---|
Name | Equol |
---|
Frequency | 386.0 |
---|
Structure | |
---|
Chemical Formula | C15H14O3 |
---|
Molecular Mass | 242.0943 |
---|
SMILES | Oc1ccc(C2COc3cc(O)ccc3C2)cc1 |
---|
InChI Key | ADFCQWZHKCXPAJ-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | isoflavonoids |
---|
Subclass | isoflavans |
---|
Direct Parent | isoflavanols |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersbenzene and substituted derivativeshydrocarbon derivativesoxacyclic compounds |
---|
Substituents | monocyclic benzene moietyetherbenzopyran1-benzopyranisoflavanol1-hydroxy-2-unsubstituted benzenoidalkyl aryl etheroxacycleorganic oxygen compoundaromatic heteropolycyclic compoundchromanephenolhydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compound |
---|