| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:38:27 UTC |
|---|
| Update Date | 2025-03-21 17:58:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00011895 |
|---|
| Frequency | 385.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H9O9P |
|---|
| Molecular Mass | 243.9984 |
|---|
| SMILES | O=C(CO)C(O)C(O)C(=O)OP(=O)(O)O |
|---|
| InChI Key | KLCWSFPEPSNDCP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | pentose phosphates |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | acyl monophosphatesacyloinsalpha-hydroxy ketonesbeta hydroxy acids and derivativesbeta-hydroxy ketonesgamma-keto acids and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganic phosphoric acids and derivativessecondary alcohols |
|---|
| Substituents | beta-hydroxy ketonealiphatic acyclic compoundcarbonyl grouppentose phosphatealpha-hydroxy ketonecarboxylic acid derivativeketonebeta-hydroxy acidorganic oxidealcoholacyl monophosphatehydroxy acidgamma-keto acidmonocarboxylic acid or derivativesketo acidacyloinsecondary alcoholhydrocarbon derivativeorganic phosphoric acid derivativeacyl phosphate |
|---|
