| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:38:30 UTC |
|---|
| Update Date | 2025-03-21 17:58:04 UTC |
|---|
| HMDB ID | HMDB0037314 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00011984 |
|---|
| Name | Norartocarpanone |
|---|
| Frequency | 382.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H12O6 |
|---|
| Molecular Mass | 288.0634 |
|---|
| SMILES | O=C1CC(c2ccc(O)cc2O)Oc2cc(O)cc(O)c21 |
|---|
| InChI Key | QBLQLKNOKUHRCH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | flavans |
|---|
| Direct Parent | flavanones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids4'-hydroxyflavonoids5-hydroxyflavonoids7-hydroxyflavonoidsalkyl aryl ethersaryl alkyl ketonesbenzene and substituted derivativeschromoneshydrocarbon derivativesorganic oxidesoxacyclic compoundsresorcinolsvinylogous acids |
|---|
| Substituents | monocyclic benzene moietyetheraryl alkyl ketone1-benzopyranflavanone1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherresorcinolketoneorganic oxidechromonearomatic heteropolycyclic compoundchromaneorganoheterocyclic compoundbenzopyran5-hydroxyflavonoid1-hydroxy-4-unsubstituted benzenoidoxacyclevinylogous acidorganic oxygen compound7-hydroxyflavonoid4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganooxygen compoundaryl ketone |
|---|