| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:38:33 UTC |
|---|
| Update Date | 2025-03-21 17:58:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00012122 |
|---|
| Frequency | 376.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H10O7 |
|---|
| Molecular Mass | 206.0427 |
|---|
| SMILES | COC(=O)CC(O)(CC(=O)O)C(=O)O |
|---|
| InChI Key | YUTUUOJFXIMELV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | tricarboxylic acids and derivatives |
|---|
| Direct Parent | tricarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativescarbonyl compoundscarboxylic acidsfatty acid methyl estershydrocarbon derivativesmethyl estersorganic oxidestertiary alcohols |
|---|
| Substituents | alcoholfatty acylaliphatic acyclic compoundcarbonyl groupcarboxylic acidalpha-hydroxy acidtricarboxylic acid or derivativeshydroxy acidfatty acid estertertiary alcoholorganic oxidefatty acid methyl estermethyl esterorganic oxygen compoundcarboxylic acid esterhydrocarbon derivativeorganooxygen compound |
|---|
