| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:38:35 UTC |
|---|
| Update Date | 2025-03-21 17:58:06 UTC |
|---|
| HMDB ID | HMDB0255854 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00012195 |
|---|
| Name | O-Desmethyldiltiazem |
|---|
| Frequency | 374.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H24N2O4S |
|---|
| Molecular Mass | 400.1457 |
|---|
| SMILES | CC(=O)OC1C(=O)N(CCN(C)C)c2ccccc2SC1c1ccc(O)cc1 |
|---|
| InChI Key | ALISTFINEQANJP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | benzothiazepines |
|---|
| Subclass | benzothiazepines |
|---|
| Direct Parent | benzothiazepines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkylarylthioethersamino acids and derivativesazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboxylic acid estershydrocarbon derivativeslactamsmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundstertiary carboxylic acid amidestrialkylamines |
|---|
| Substituents | monocyclic benzene moietycarbonyl grouplactamamino acid or derivatives1-hydroxy-2-unsubstituted benzenoidalkylarylthioethercarboxylic acid derivativearyl thioetherorganic oxidearomatic heteropolycyclic compoundtertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundbenzothiazepinetertiary amineazacycletertiary aliphatic aminecarboxamide groupmonocarboxylic acid or derivativesorganic oxygen compoundthioethercarboxylic acid esterphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|
