Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-20 23:38:35 UTC |
---|
Update Date | 2025-03-21 17:58:06 UTC |
---|
HMDB ID | HMDB0014440 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00012204 |
---|
Name | Morphine |
---|
Frequency | 373.6 |
---|
Structure | |
---|
Chemical Formula | C17H19NO3 |
---|
Molecular Mass | 285.1365 |
---|
SMILES | CN1CCC23c4c5ccc(O)c4OC2C(O)C=CC3C1C5 |
---|
InChI Key | BQJCRHHNABKAKU-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | alkaloids and derivatives |
---|
Class | morphinans |
---|
Subclass | morphinans |
---|
Direct Parent | morphinans |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersazacyclic compoundscoumaranshydrocarbon derivativesorganopnictogen compoundsoxacyclic compoundsphenanthrenes and derivativespiperidinessecondary alcoholstetralinstrialkylamines |
---|
Substituents | tetralinether1-hydroxy-2-unsubstituted benzenoidalkyl aryl etheraromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundpiperidinetertiary amineorganoheterocyclic compoundcoumaranalcoholphenanthreneazacycletertiary aliphatic amineoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundmorphinanamineorganooxygen compound |
---|