| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:38:42 UTC |
|---|
| Update Date | 2025-03-21 17:58:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00012481 |
|---|
| Frequency | 363.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H11N |
|---|
| Molecular Mass | 193.0891 |
|---|
| SMILES | c1ccc(-c2c[nH]c3ccccc23)cc1 |
|---|
| InChI Key | XZNGTBLWFCRXKR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | indoles |
|---|
| Direct Parent | indoles |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesorganonitrogen compoundsorganopnictogen compoundspyrroles |
|---|
| Substituents | monocyclic benzene moietyazacycleindoleheteroaromatic compoundaromatic heteropolycyclic compoundpyrroleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compound |
|---|