| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:38:50 UTC |
|---|
| Update Date | 2025-03-21 17:58:11 UTC |
|---|
| HMDB ID | HMDB0060319 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00012777 |
|---|
| Name | (S)-N-Methylcoclaurine |
|---|
| Frequency | 354.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H21NO3 |
|---|
| Molecular Mass | 299.1521 |
|---|
| SMILES | COc1cc2c(cc1O)C(Cc1ccc(O)cc1)N(C)CC2 |
|---|
| InChI Key | BOKVLBSSPUTWLV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | isoquinolines and derivatives |
|---|
| Subclass | benzylisoquinolines |
|---|
| Direct Parent | benzylisoquinolines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersanisolesaralkylaminesazacyclic compoundsbenzene and substituted derivativeshydrocarbon derivativesorganopnictogen compoundstetrahydroisoquinolinestrialkylamines |
|---|
| Substituents | phenol ethermonocyclic benzene moietyetherazacycletertiary aliphatic amine1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherbenzylisoquinolinearalkylamineorganic oxygen compoundaromatic heteropolycyclic compoundanisoleorganonitrogen compoundtetrahydroisoquinolineorganopnictogen compoundphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundaminetertiary amineorganooxygen compound |
|---|
