| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:38:51 UTC |
|---|
| Update Date | 2025-03-21 17:58:12 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00012823 |
|---|
| Frequency | 352.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H8N5O5P |
|---|
| Molecular Mass | 285.0263 |
|---|
| SMILES | Nc1ncnc2c1ncn2C1OC2OP(=O)(O)OC21 |
|---|
| InChI Key | BRNSCFDOJUHNIE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | purines and purine derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsdioxaphospholanesheteroaromatic compoundshydrocarbon derivativesimidazolesimidolactamsn-substituted imidazolesorganic oxidesorganic phosphoric acids and derivativesorganooxygen compoundsorganopnictogen compoundsoxacyclic compoundsoxetanesprimary aminespyrimidines and pyrimidine derivatives |
|---|
| Substituents | pyrimidineorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundimidolactamazolen-substituted imidazoleazacycleheteroaromatic compound1,3_dioxaphospholaneoxacycleorganic oxygen compoundoxetanehydrocarbon derivativeprimary aminepurineorganic nitrogen compoundorganic phosphoric acid derivativeamineorganooxygen compound |
|---|
