| Record Information |
|---|
| HMDB Status | expected |
|---|
| Creation Date | 2024-02-20 23:38:53 UTC |
|---|
| Update Date | 2025-03-21 17:58:13 UTC |
|---|
| HMDB ID | HMDB0303976 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00012927 |
|---|
| Name | (4S)-4-hydroxy-2,3,4,5-tetrahydro-(2S)-dipicolinate |
|---|
| Frequency | 349.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H9NO5 |
|---|
| Molecular Mass | 187.0481 |
|---|
| SMILES | O=C(O)C1=NC(C(=O)O)CC(O)C1 |
|---|
| InChI Key | DVTPRYHENFBCII-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesketiminesorganic oxidesorganopnictogen compoundspropargyl-type 1,3-dipolar organic compoundssecondary alcoholstetrahydropyridines |
|---|
| Substituents | alcoholketiminecarbonyl groupcarboxylic acidazacycleiminetetrahydropyridineorganic 1,3-dipolar compoundpropargyl-type 1,3-dipolar organic compoundorganic oxideorganic oxygen compoundaliphatic heteromonocyclic compoundorganonitrogen compoundalpha-amino acidsecondary alcoholdicarboxylic acid or derivativesorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganoheterocyclic compoundorganooxygen compound |
|---|
