| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:38:53 UTC |
|---|
| Update Date | 2025-03-21 17:58:13 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00012929 |
|---|
| Frequency | 349.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H13O12PS |
|---|
| Molecular Mass | 339.9865 |
|---|
| SMILES | O=P(O)(O)OC1OC(COS(=O)(=O)O)C(O)C(O)C1O |
|---|
| InChI Key | JRQXNDDROPWLRC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | monoalkyl phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | alkyl sulfateshydrocarbon derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanessecondary alcoholssulfuric acid monoesters |
|---|
| Substituents | alcoholsulfuric acid monoesterorganic sulfuric acid or derivativesmonosaccharideoxacyclesaccharideorganic oxideorganic oxygen compoundmonoalkyl phosphatealkyl sulfatealiphatic heteromonocyclic compoundsecondary alcoholsulfate-esterhydrocarbon derivativeoxanesulfuric acid esterorganoheterocyclic compoundorganooxygen compound |
|---|
