Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-20 23:38:54 UTC |
---|
Update Date | 2025-03-21 17:58:13 UTC |
---|
HMDB ID | HMDB0034138 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00012953 |
---|
Name | Repensol |
---|
Frequency | 348.3 |
---|
Structure | |
---|
Chemical Formula | C15H8O6 |
---|
Molecular Mass | 284.0321 |
---|
SMILES | O=c1oc2cc(O)ccc2c2oc3cc(O)cc(O)c3c12 |
---|
InChI Key | CFUAZBGEKBTCSH-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | isoflavonoids |
---|
Subclass | coumestans |
---|
Direct Parent | coumestans |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsangular furanocoumarinsbenzenoidsbenzofuransfuransfuropyransheteroaromatic compoundshydrocarbon derivativeslactonesorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivatives |
---|
Substituents | furanfuranocoumarinbenzopyranbenzofuran1-benzopyranheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidfuropyran1-hydroxy-4-unsubstituted benzenoidcoumarinangular furanocoumarinlactoneoxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyranpyranonecoumestanhydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compound |
---|