Record Information |
---|
HMDB Status | expected |
---|
Creation Date | 2024-02-20 23:38:55 UTC |
---|
Update Date | 2025-03-21 17:58:13 UTC |
---|
HMDB ID | HMDB0030266 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00013006 |
---|
Name | Berberrubine |
---|
Frequency | 346.6 |
---|
Structure | |
---|
Chemical Formula | C19H16NO4+ |
---|
Molecular Mass | 322.1074 |
---|
SMILES | COc1ccc2cc3[n+](cc2c1O)CCc1cc2c(cc1-3)OCO2 |
---|
InChI Key | GLYPKDKODVRYGP-UHFFFAOYSA-O |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | alkaloids and derivatives |
---|
Class | protoberberine alkaloids and derivatives |
---|
Subclass | protoberberine alkaloids and derivatives |
---|
Direct Parent | protoberberine alkaloids and derivatives |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | 1-hydroxy-4-unsubstituted benzenoids2-halopyridinesacetalsalkyl aryl ethersanisolesazacyclic compoundsbenzodioxolesheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesisoquinolines and derivativesmethylpyridinesorganic cationsorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundspolyhalopyridinesquinolizines |
---|
Substituents | tetrahydroprotoberberine skeletonphenol etheretherpolyhalopyridinealkyl aryl etheracetalaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compound2-halopyridineorganic cationorganoheterocyclic compoundbenzodioxolequinolizineazacycleheteroaromatic compoundhydroxypyridinemethylpyridine1-hydroxy-4-unsubstituted benzenoidprotoberberine skeletonoxacyclepyridineorganic oxygen compoundanisoleisoquinolinehydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
---|