| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:38:58 UTC |
|---|
| Update Date | 2025-03-21 17:58:15 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00013092 |
|---|
| Frequency | 344.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H11NO6S |
|---|
| Molecular Mass | 261.0307 |
|---|
| SMILES | COS(=O)(=O)Oc1ccc(NC(C)=O)c(O)c1 |
|---|
| InChI Key | UZJSCUIBELCSPB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | acetanilides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetamidesalkyl sulfatesarylsulfatescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-acetylarylaminesorganic oxidesorganopnictogen compoundsphenoxy compoundssecondary carboxylic acid amidessulfuric acid diesters |
|---|
| Substituents | carbonyl groupn-acetylarylamine1-hydroxy-2-unsubstituted benzenoidn-arylamidecarboxylic acid derivativeorganic oxidesulfuric acid diesteralkyl sulfateorganonitrogen compoundorganopnictogen compoundarylsulfateacetamideorganic sulfuric acid or derivativesacetanilide1-hydroxy-4-unsubstituted benzenoidcarboxamide grouparomatic homomonocyclic compoundsecondary carboxylic acid amideorganic oxygen compoundphenolhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundsulfuric acid esterorganooxygen compound |
|---|
