| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:38:59 UTC |
|---|
| Update Date | 2025-03-21 17:58:14 UTC |
|---|
| HMDB ID | HMDB0247091 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00013146 |
|---|
| Name | 4(1H)-Pteridinone, 2-amino-6-methyl- |
|---|
| Frequency | 563.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H7N5O |
|---|
| Molecular Mass | 177.0651 |
|---|
| SMILES | Cc1cnc2nc(N)[nH]c(=O)c2n1 |
|---|
| InChI Key | UDOGNMDURIJYQC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativeslactamsorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary aminespyrazinespyrimidones |
|---|
| Substituents | pterinlactamazacycleheteroaromatic compoundpyrimidonepyrimidineorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyrazineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
