Record Information |
---|
HMDB Status | detected |
---|
Creation Date | 2024-02-20 23:39:01 UTC |
---|
Update Date | 2025-03-21 17:58:15 UTC |
---|
HMDB ID | HMDB0251202 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00013238 |
---|
Name | Dichlorprop |
---|
Frequency | 339.1 |
---|
Structure | |
---|
Chemical Formula | C9H8Cl2O3 |
---|
Molecular Mass | 233.985 |
---|
SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)O |
---|
InChI Key | MZHCENGPTKEIGP-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | benzenoids |
---|
Class | benzene and substituted derivatives |
---|
Subclass | 2-phenoxypropionic acids |
---|
Direct Parent | 2-phenoxypropionic acids |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | alkyl aryl ethersaryl chloridescarbonyl compoundscarboxylic acidsdichlorobenzeneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganochloridesphenol ethersphenoxy compoundsphenoxyacetic acid derivatives |
---|
Substituents | phenol etherphenoxyacetatecarbonyl groupethercarboxylic acidorganochloridealkyl aryl ethercarboxylic acid derivativeorganohalogen compound1,3-dichlorobenzeneorganic oxidearyl chloridechlorobenzene2-phenoxypropionic acidaryl halidearomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativehalobenzenephenoxy compoundorganooxygen compound |
---|