| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-20 23:39:01 UTC |
|---|
| Update Date | 2025-03-21 17:58:15 UTC |
|---|
| HMDB ID | HMDB0251202 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00013238 |
|---|
| Name | Dichlorprop |
|---|
| Frequency | 339.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H8Cl2O3 |
|---|
| Molecular Mass | 233.985 |
|---|
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)O |
|---|
| InChI Key | MZHCENGPTKEIGP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | 2-phenoxypropionic acids |
|---|
| Direct Parent | 2-phenoxypropionic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersaryl chloridescarbonyl compoundscarboxylic acidsdichlorobenzeneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganochloridesphenol ethersphenoxy compoundsphenoxyacetic acid derivatives |
|---|
| Substituents | phenol etherphenoxyacetatecarbonyl groupethercarboxylic acidorganochloridealkyl aryl ethercarboxylic acid derivativeorganohalogen compound1,3-dichlorobenzeneorganic oxidearyl chloridechlorobenzene2-phenoxypropionic acidaryl halidearomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativehalobenzenephenoxy compoundorganooxygen compound |
|---|
